C20H18O6 — CID 162978758
1,4,7,10-tetrahydroxy-1,2,3a,6b,7,8,12b,12c-octahydroperylene-3,9-dione (PubChem CID 162978758) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1,4,7,10-tetrahydroxy-1,2,3a,6b,7,8,12b,12c-octahydroperylene-3,9-dione.
| Compound Name | 1,4,7,10-tetrahydroxy-1,2,3a,6b,7,8,12b,12c-octahydroperylene-3,9-dione |
|---|---|
| PubChem CID | 162978758 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1,4,7,10-tetrahydroxy-1,2,3a,6b,7,8,12b,12c-octahydroperylene-3,9-dione |
| SMILES | O=C1CC(O)C2C3=CC=C(O)C4C(=O)CC(O)C(c5ccc(O)c1c52)C34 |
| InChI | InChI=1S/C20H18O6/c21-9-3-1-7-15-11(23)5-14(26)20-10(22)4-2-8(18(15)20)16-12(24)6-13(25)19(9)17(7)16/h1-4,11-12,15-17,19,21-24H,5-6H2 |
| InChIKey | DWOCCFIVAZHADR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |