C11H11Br2N5O3 — CID 163037498
N-[(2S,3Z)-3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4,5-dibromo-1H-pyrrole-2-carboxamide (PubChem CID 163037498) has the molecular formula C11H11Br2N5O3 and a molecular weight of 421.05 g/mol. Its IUPAC name is N-[(2S,3Z)-3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4,5-dibromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2S,3Z)-3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4,5-dibromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 163037498 |
| Molecular Formula | C11H11Br2N5O3 |
| Molecular Weight | 421.05 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | N-[(2S,3Z)-3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4,5-dibromo-1H-pyrrole-2-carboxamide |
| SMILES | NC1=N/C(=C\[C@H](O)CNC(=O)c2cc(Br)c(Br)[nH]2)C(=O)N1 |
| InChI | InChI=1S/C11H11Br2N5O3/c12-5-2-7(16-8(5)13)9(20)15-3-4(19)1-6-10(21)18-11(14)17-6/h1-2,4,16,19H,3H2,(H,15,20)(H3,14,17,18,21)/b6-1-/t4-/m0/s1 |
| InChIKey | AOPZOWUSQQHDPT-RDTQVNCESA-N |
| XLogP | -0.04 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.05 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|