C17H20Br5N5O2 — CID 163110850
3,4,5-tribromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide (PubChem CID 163110850) has the molecular formula C17H20Br5N5O2 and a molecular weight of 725.90 g/mol. Its IUPAC name is 3,4,5-tribromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 3,4,5-tribromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 163110850 |
| Molecular Formula | C17H20Br5N5O2 |
| Molecular Weight | 725.90 g/mol |
| Exact Mass | 720.75 |
| IUPAC Name | 3,4,5-tribromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCCNCCCCNC(=O)c1[nH]c(Br)c(Br)c1Br)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C17H20Br5N5O2/c18-9-8-10(26-14(9)21)16(28)24-7-3-5-23-4-1-2-6-25-17(29)13-11(19)12(20)15(22)27-13/h8,23,26-27H,1-7H2,(H,24,28)(H,25,29) |
| InChIKey | LOVKSJCBMNZPKX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|