C30H44O9 — CID 163040360
[10-acetyloxy-1-butanoyloxy-5,9-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] butanoate (PubChem CID 163040360) has the molecular formula C30H44O9 and a molecular weight of 548.67 g/mol. Its IUPAC name is [10-acetyloxy-1-butanoyloxy-5,9-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] butanoate.
| Compound Name | [10-acetyloxy-1-butanoyloxy-5,9-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] butanoate |
|---|---|
| PubChem CID | 163040360 |
| Molecular Formula | C30H44O9 |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | [10-acetyloxy-1-butanoyloxy-5,9-dihydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-3-yl] butanoate |
| SMILES | C=CC(C)=CCC1(C)C(C)C(O)C(OC(C)=O)C23C(=CC(O)CC12)C(OC(=O)CCC)OC3OC(=O)CCC |
| InChI | InChI=1S/C30H44O9/c1-8-11-23(33)37-27-21-15-20(32)16-22-29(7,14-13-17(4)10-3)18(5)25(35)26(36-19(6)31)30(21,22)28(39-27)38-24(34)12-9-2/h10,13,15,18,20,22,25-28,32,35H,3,8-9,11-12,14,16H2,1-2,4-7H3 |
| InChIKey | KGWLIKQXAVVBFW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|