C26H42O3 — CID 163044618
methyl (1Z,4R,7E,11Z)-4-(6-hydroxy-6-methylhept-1-en-2-yl)-7,11-dimethylcyclotetradeca-1,7,11-triene-1-carboxylate (PubChem CID 163044618) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is methyl (1Z,4R,7E,11Z)-4-(6-hydroxy-6-methylhept-1-en-2-yl)-7,11-dimethylcyclotetradeca-1,7,11-triene-1-carboxylate.
| Compound Name | methyl (1Z,4R,7E,11Z)-4-(6-hydroxy-6-methylhept-1-en-2-yl)-7,11-dimethylcyclotetradeca-1,7,11-triene-1-carboxylate |
|---|---|
| PubChem CID | 163044618 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | methyl (1Z,4R,7E,11Z)-4-(6-hydroxy-6-methylhept-1-en-2-yl)-7,11-dimethylcyclotetradeca-1,7,11-triene-1-carboxylate |
| SMILES | C=C(CCCC(C)(C)O)[C@H]1C/C=C(\C(=O)OC)CC/C=C(/C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C26H42O3/c1-20-10-7-11-21(2)15-16-23(22(3)13-9-19-26(4,5)28)17-18-24(14-8-12-20)25(27)29-6/h11-12,18,23,28H,3,7-10,13-17,19H2,1-2,4-6H3/b20-12-,21-11+,24-18-/t23-/m1/s1 |
| InChIKey | XZCDHJHKPRCMJX-MZFMWBAISA-N |
| XLogP | 6.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|