C25H40O4 — CID 163046586
[(1R,2E,4S,6S,8E,12E)-4-hydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradeca-2,8,12-trien-1-yl] (2R,3S)-3-hydroxy-2-methylbutanoate (PubChem CID 163046586) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is [(1R,2E,4S,6S,8E,12E)-4-hydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradeca-2,8,12-trien-1-yl] (2R,3S)-3-hydroxy-2-methylbutanoate.
| Compound Name | [(1R,2E,4S,6S,8E,12E)-4-hydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradeca-2,8,12-trien-1-yl] (2R,3S)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 163046586 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(1R,2E,4S,6S,8E,12E)-4-hydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradeca-2,8,12-trien-1-yl] (2R,3S)-3-hydroxy-2-methylbutanoate |
| SMILES | C=C(C)[C@H]1C/C=C(\C)CC/C=C(\C)C[C@@H](OC(=O)[C@H](C)[C@H](C)O)/C=C(\C)[C@@H](O)C1 |
| InChI | InChI=1S/C25H40O4/c1-16(2)22-12-11-17(3)9-8-10-18(4)13-23(14-19(5)24(27)15-22)29-25(28)20(6)21(7)26/h10-11,14,20-24,26-27H,1,8-9,12-13,15H2,2-7H3/b17-11+,18-10+,19-14+/t20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | YUMLJLDCYHFOIA-SJQVCANQSA-N |
| XLogP | 5.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|