C18H20O4 — CID 163047187
[(E,5S)-5-acetyloxytetradec-6-en-8,10,12-triynyl] acetate (PubChem CID 163047187) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(E,5S)-5-acetyloxytetradec-6-en-8,10,12-triynyl] acetate.
| Compound Name | [(E,5S)-5-acetyloxytetradec-6-en-8,10,12-triynyl] acetate |
|---|---|
| PubChem CID | 163047187 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(E,5S)-5-acetyloxytetradec-6-en-8,10,12-triynyl] acetate |
| SMILES | CC#CC#CC#C/C=C/[C@H](CCCCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H20O4/c1-4-5-6-7-8-9-10-13-18(22-17(3)20)14-11-12-15-21-16(2)19/h10,13,18H,11-12,14-15H2,1-3H3/b13-10+/t18-/m1/s1 |
| InChIKey | CMCNGTPCRZUCOY-LVMGUKCRSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|