C23H20O8 — CID 163050112
methyl 4,5,7-trihydroxy-6,11-dioxo-2-(2-oxopropyl)-1,2,3,4-tetrahydrotetracene-1-carboxylate (PubChem CID 163050112) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is methyl 4,5,7-trihydroxy-6,11-dioxo-2-(2-oxopropyl)-1,2,3,4-tetrahydrotetracene-1-carboxylate.
| Compound Name | methyl 4,5,7-trihydroxy-6,11-dioxo-2-(2-oxopropyl)-1,2,3,4-tetrahydrotetracene-1-carboxylate |
|---|---|
| PubChem CID | 163050112 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl 4,5,7-trihydroxy-6,11-dioxo-2-(2-oxopropyl)-1,2,3,4-tetrahydrotetracene-1-carboxylate |
| SMILES | COC(=O)C1c2cc3c(c(O)c2C(O)CC1CC(C)=O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C23H20O8/c1-9(24)6-10-7-15(26)18-12(16(10)23(30)31-2)8-13-19(22(18)29)21(28)17-11(20(13)27)4-3-5-14(17)25/h3-5,8,10,15-16,25-26,29H,6-7H2,1-2H3 |
| InChIKey | DEGQGYBKXGMYQP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|