C29H38O6 — CID 163053163
12,17-dihydroxy-8,12,17,21,25-pentamethyl-6,23-dioxaheptacyclo[13.9.2.01,16.02,14.04,13.05,9.020,24]hexacosa-3,25-diene-7,22-dione (PubChem CID 163053163) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is 12,17-dihydroxy-8,12,17,21,25-pentamethyl-6,23-dioxaheptacyclo[13.9.2.01,16.02,14.04,13.05,9.020,24]hexacosa-3,25-diene-7,22-dione.
| Compound Name | 12,17-dihydroxy-8,12,17,21,25-pentamethyl-6,23-dioxaheptacyclo[13.9.2.01,16.02,14.04,13.05,9.020,24]hexacosa-3,25-diene-7,22-dione |
|---|---|
| PubChem CID | 163053163 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 12,17-dihydroxy-8,12,17,21,25-pentamethyl-6,23-dioxaheptacyclo[13.9.2.01,16.02,14.04,13.05,9.020,24]hexacosa-3,25-diene-7,22-dione |
| SMILES | CC1=CC2C3C4C(=CC3C13C1OC(=O)C(C)C1CCC(C)(O)C23)C1OC(=O)C(C)C1CCC4(C)O |
| InChI | InChI=1S/C29H38O6/c1-12-10-17-20-19(11-18-21(20)27(4,32)8-6-15-13(2)25(30)34-22(15)18)29(12)23(17)28(5,33)9-7-16-14(3)26(31)35-24(16)29/h10-11,13-17,19-24,32-33H,6-9H2,1-5H3 |
| InChIKey | MKGMIRMCPNPOAA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|