About CID 163057117
CID 163057117 (PubChem CID 163057117) has the molecular formula C32H28O12
and a molecular weight of 604.56 g/mol.
Molecular Properties
| Compound Name | CID 163057117 |
| PubChem CID | 163057117 |
| Molecular Formula | C32H28O12 |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | — |
| SMILES | Oc1ccc2c(c1)OCC1(Cc3cc(O)c(O)cc3-2)OC(O)C2(COc3cc(O)ccc3-c3cc(O)c(O)cc3C2)OC1O |
| InChI | InChI=1S/C32H28O12/c33-17-1-3-19-21-9-25(37)23(35)5-15(21)11-31(13-41-27(19)7-17)29(39)44-32(30(40)43-31)12-16-6-24(36)26(38)10-22(16)20-4-2-18(34)8-28(20)42-14-32/h1-10,29-30,33-40H,11-14H2 |
| InChIKey | STXCPHYYQFRWCD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze CID 163057117 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163057117?
The IUPAC name of CID 163057117 (CID 163057117) is not available.
What is the SMILES notation for CID 163057117?
The canonical SMILES for CID 163057117 is Oc1ccc2c(c1)OCC1(Cc3cc(O)c(O)cc3-2)OC(O)C2(COc3cc(O)ccc3-c3cc(O)c(O)cc3C2)OC1O.
What is the InChIKey of CID 163057117?
The InChIKey is STXCPHYYQFRWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H28O12/c33-17-1-3-19-21-9-25(37)23(35)5-15(21)11-31(13-41-27(19)7-17)29(39)44-32(30(40)43-31)12-16-6-24(36)26(38)10-22(16)20-4-2-18(34)8-28(20)42-14-32/h1-10,29-30,33-40H,11-14H2.
What are the key properties of CID 163057117?
CID 163057117 has a molecular weight of 604.56 g/mol, XLogP of 2.99, 0 rotatable bonds, 8 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163057117 is sourced from PubChem (CID 163057117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).