C37H44O15 — CID 163061025
[9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] but-2-enoate (PubChem CID 163061025) has the molecular formula C37H44O15 and a molecular weight of 728.74 g/mol. Its IUPAC name is [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] but-2-enoate.
| Compound Name | [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] but-2-enoate |
|---|---|
| PubChem CID | 163061025 |
| Molecular Formula | C37H44O15 |
| Molecular Weight | 728.74 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] but-2-enoate |
| SMILES | CC=CC(=O)OC1C(C)(C)C(C(OC(C)=O)C(=O)OC)C2(C)C(=O)C1(O)C(OC(C)=O)C1=C3C(OC(C)=O)C(=O)OC(c4ccoc4)C3(C)CCC12 |
| InChI | InChI=1S/C37H44O15/c1-10-11-22(41)51-33-34(5,6)27(26(30(42)46-9)49-18(3)39)36(8)21-12-14-35(7)24(23(21)29(50-19(4)40)37(33,45)32(36)44)25(48-17(2)38)31(43)52-28(35)20-13-15-47-16-20/h10-11,13,15-16,21,25-29,33,45H,12,14H2,1-9H3 |
| InChIKey | MBGIGFVWRPHBRZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 208.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|