C38H48O15 — CID 163077946
[9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbutanoate (PubChem CID 163077946) has the molecular formula C38H48O15 and a molecular weight of 744.79 g/mol. Its IUPAC name is [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbutanoate.
| Compound Name | [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 163077946 |
| Molecular Formula | C38H48O15 |
| Molecular Weight | 744.79 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | [9,12-diacetyloxy-16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(C)(C)C(C(OC(C)=O)C(=O)OC)C2(C)C(=O)C1(O)C(OC(C)=O)C1=C3C(OC(C)=O)C(=O)OC(c4ccoc4)C3(C)CCC12 |
| InChI | InChI=1S/C38H48O15/c1-11-17(2)30(42)53-34-35(6,7)27(26(31(43)47-10)50-19(4)40)37(9)22-12-14-36(8)24(23(22)29(51-20(5)41)38(34,46)33(37)45)25(49-18(3)39)32(44)52-28(36)21-13-15-48-16-21/h13,15-17,22,25-29,34,46H,11-12,14H2,1-10H3 |
| InChIKey | BWCSGOWTJYZFLM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 208.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|