About 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one
1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one (PubChem CID 163065158) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one.
Analyze 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one?
The IUPAC name of 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one (CID 163065158) is 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one.
What is the SMILES notation for 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one?
The canonical SMILES for 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one is CC12CC3C(=O)OC(CO1)C3O2.
What is the InChIKey of 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one?
The InChIKey is CLPLRRVKMWVWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-8-2-4-6(12-8)5(3-10-8)11-7(4)9/h4-6H,2-3H2,1H3.
What are the key properties of 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one?
1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one has a molecular weight of 170.16 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,5,9-trioxatricyclo[5.2.1.04,8]decan-6-one is sourced from PubChem (CID 163065158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).