About 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one
7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one (PubChem CID 72755635) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one.
Analyze 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one?
The IUPAC name of 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one (CID 72755635) is 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one.
What is the SMILES notation for 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one?
The canonical SMILES for 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one is CC12CC3OC(=O)CC3(CCO1)O2.
What is the InChIKey of 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one?
The InChIKey is QIUBALCNECIHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-8-4-6-9(13-8,2-3-11-8)5-7(10)12-6/h6H,2-5H2,1H3.
What are the key properties of 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one?
7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one has a molecular weight of 184.19 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4,8,11-trioxatricyclo[5.3.1.01,5]undecan-3-one is sourced from PubChem (CID 72755635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).