C12H18O6 — CID 10945102
(1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one (PubChem CID 10945102) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one.
| Compound Name | (1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
|---|---|
| PubChem CID | 10945102 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
| SMILES | CO[C@@]12CC(=O)OC[C@@](C)(O1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C12H18O6/c1-10(2)16-8-9(17-10)12(14-4)5-7(13)15-6-11(8,3)18-12/h8-9H,5-6H2,1-4H3/t8-,9+,11+,12-/m0/s1 |
| InChIKey | VTLDZBAOAZTEDW-SPFNVWMYSA-N |
| XLogP | 0.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |