C13H20O5 — CID 163065174
6-(1,2-dihydroxyheptyl)-4-methoxypyran-2-one (PubChem CID 163065174) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 6-(1,2-dihydroxyheptyl)-4-methoxypyran-2-one.
| Compound Name | 6-(1,2-dihydroxyheptyl)-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 163065174 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 6-(1,2-dihydroxyheptyl)-4-methoxypyran-2-one |
| SMILES | CCCCCC(O)C(O)c1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C13H20O5/c1-3-4-5-6-10(14)13(16)11-7-9(17-2)8-12(15)18-11/h7-8,10,13-14,16H,3-6H2,1-2H3 |
| InChIKey | JSXSFKUJRDZOID-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|