C10H14O5 — CID 170988717
6-[(1R)-1,4-dihydroxybutyl]-4-methoxypyran-2-one (PubChem CID 170988717) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-[(1R)-1,4-dihydroxybutyl]-4-methoxypyran-2-one.
| Compound Name | 6-[(1R)-1,4-dihydroxybutyl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 170988717 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 6-[(1R)-1,4-dihydroxybutyl]-4-methoxypyran-2-one |
| SMILES | COc1cc([C@H](O)CCCO)oc(=O)c1 |
| InChI | InChI=1S/C10H14O5/c1-14-7-5-9(15-10(13)6-7)8(12)3-2-4-11/h5-6,8,11-12H,2-4H2,1H3/t8-/m1/s1 |
| InChIKey | HRMIKELLYOJOBL-MRVPVSSYSA-N |
| XLogP | 0.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |