C17H23NO5 — CID 163066064
3-dodeca-2,4,6,10-tetraenoyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 163066064) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-dodeca-2,4,6,10-tetraenoyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 3-dodeca-2,4,6,10-tetraenoyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 163066064 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-dodeca-2,4,6,10-tetraenoyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | CC=CCCC=CC=CC=CC(=O)C1(O)C(=O)NC(CO)C1O |
| InChI | InChI=1S/C17H23NO5/c1-2-3-4-5-6-7-8-9-10-11-14(20)17(23)15(21)13(12-19)18-16(17)22/h2-3,6-11,13,15,19,21,23H,4-5,12H2,1H3,(H,18,22) |
| InChIKey | CYJHCBKMADLSOZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|