C22H30O4 — CID 163066365
[(1R,2R,4S,7S,9R,11R,12E)-4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl] acetate (PubChem CID 163066365) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1R,2R,4S,7S,9R,11R,12E)-4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl] acetate.
| Compound Name | [(1R,2R,4S,7S,9R,11R,12E)-4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl] acetate |
|---|---|
| PubChem CID | 163066365 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1R,2R,4S,7S,9R,11R,12E)-4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl] acetate |
| SMILES | CC(=O)O/C1=C2\C=C(C)C(=O)[C@H]2[C@H]2O[C@@]2(C)CC[C@H]2[C@@H](C[C@H]1C)C2(C)C |
| InChI | InChI=1S/C22H30O4/c1-11-9-14-17(18(11)24)20-22(6,26-20)8-7-15-16(21(15,4)5)10-12(2)19(14)25-13(3)23/h9,12,15-17,20H,7-8,10H2,1-6H3/b19-14+/t12-,15+,16-,17+,20-,22+/m1/s1 |
| InChIKey | HQTDVSPKCOYAQC-RWQVCBMDSA-N |
| XLogP | 4.20 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|