C22H30O4 — CID 85434189
(4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl) acetate (PubChem CID 85434189) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl) acetate.
| Compound Name | (4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl) acetate |
|---|---|
| PubChem CID | 85434189 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (4,8,8,11,15-pentamethyl-16-oxo-3-oxatetracyclo[11.3.0.02,4.07,9]hexadeca-12,14-dien-12-yl) acetate |
| SMILES | CC(=O)OC1=C2C=C(C)C(=O)C2C2OC2(C)CCC2C(CC1C)C2(C)C |
| InChI | InChI=1S/C22H30O4/c1-11-9-14-17(18(11)24)20-22(6,26-20)8-7-15-16(21(15,4)5)10-12(2)19(14)25-13(3)23/h9,12,15-17,20H,7-8,10H2,1-6H3 |
| InChIKey | HQTDVSPKCOYAQC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|