C20H30O6 — CID 163066920
methyl (E)-4-[(1R,2S,4R,4aR,6S,8aS)-4,6-dihydroxy-5,5-dimethylspiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]-2-[(2S)-oxiran-2-yl]but-2-enoate (PubChem CID 163066920) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is methyl (E)-4-[(1R,2S,4R,4aR,6S,8aS)-4,6-dihydroxy-5,5-dimethylspiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]-2-[(2S)-oxiran-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(1R,2S,4R,4aR,6S,8aS)-4,6-dihydroxy-5,5-dimethylspiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]-2-[(2S)-oxiran-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 163066920 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (E)-4-[(1R,2S,4R,4aR,6S,8aS)-4,6-dihydroxy-5,5-dimethylspiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]-2-[(2S)-oxiran-2-yl]but-2-enoate |
| SMILES | COC(=O)/C(=C/C[C@@H]1[C@H]2CC[C@H](O)C(C)(C)[C@@H]2[C@H](O)C[C@@]12CO2)[C@H]1CO1 |
| InChI | InChI=1S/C20H30O6/c1-19(2)16(22)7-5-11-13(20(10-26-20)8-14(21)17(11)19)6-4-12(15-9-25-15)18(23)24-3/h4,11,13-17,21-22H,5-10H2,1-3H3/b12-4+/t11-,13-,14-,15-,16+,17+,20-/m1/s1 |
| InChIKey | UBWLAGCFXARENL-WQTNVPMISA-N |
| XLogP | 1.44 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|