C31H45N3O3 — CID 163068618
[(1R,2S,10R,13S,14R,17S)-7-[(3R)-4-acetamido-3-methylbutyl]-8,10,14-trimethyl-5,6-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4(9),5,7,19-tetraen-17-yl] acetate (PubChem CID 163068618) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is [(1R,2S,10R,13S,14R,17S)-7-[(3R)-4-acetamido-3-methylbutyl]-8,10,14-trimethyl-5,6-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4(9),5,7,19-tetraen-17-yl] acetate.
| Compound Name | [(1R,2S,10R,13S,14R,17S)-7-[(3R)-4-acetamido-3-methylbutyl]-8,10,14-trimethyl-5,6-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4(9),5,7,19-tetraen-17-yl] acetate |
|---|---|
| PubChem CID | 163068618 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | [(1R,2S,10R,13S,14R,17S)-7-[(3R)-4-acetamido-3-methylbutyl]-8,10,14-trimethyl-5,6-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4(9),5,7,19-tetraen-17-yl] acetate |
| SMILES | CC(=O)NC[C@H](C)CCc1nnc2c(c1C)[C@]1(C)CC[C@H]3[C@@H](CC=C4C[C@@H](OC(C)=O)CC[C@@]43C)[C@@H]1C2 |
| InChI | InChI=1S/C31H45N3O3/c1-18(17-32-20(3)35)7-10-27-19(2)29-28(34-33-27)16-26-24-9-8-22-15-23(37-21(4)36)11-13-30(22,5)25(24)12-14-31(26,29)6/h8,18,23-26H,7,9-17H2,1-6H3,(H,32,35)/t18-,23+,24-,25+,26+,30+,31-/m1/s1 |
| InChIKey | MNWSPEJGVNYUQL-NSKGYINISA-N |
| XLogP | 5.40 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|