C77H86N4O14 — CID 163069757
CID 163069757 (PubChem CID 163069757) has the molecular formula C77H86N4O14 and a molecular weight of 1291.55 g/mol.
| Compound Name | CID 163069757 |
|---|---|
| PubChem CID | 163069757 |
| Molecular Formula | C77H86N4O14 |
| Molecular Weight | 1291.55 g/mol |
| Exact Mass | 1290.61 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CC5(NC6C(O)CCCC6C6CCc7ccc(O)cc7-c7cc8[nH]ccc8n7C65)C(CCCO)C4C=O)C4CC(O)CCC4C3C2CC(=O)CC(C(O)Cc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C77H86N4O14/c1-93-68-36-54-53(35-67(68)91)56-30-43-38-76(40-77(57(11-7-25-82)59(76)39-84)75-50(49-10-6-13-65(89)74(49)80-77)20-17-42-16-18-44(85)31-52(42)63-37-61-62(81(63)75)23-24-78-61)58-33-45(86)19-21-51(58)72(43)55(54)32-46(87)34-70(66(90)28-41-15-22-64(88)69(29-41)94-27-26-83)95-71(92)14-5-3-9-48-47-8-2-4-12-60(47)79-73(48)56/h2,4,8,12,15-16,18,22-24,29-31,35-37,39,43,45,49-51,55,57-59,65-66,70,72,74-75,78-80,82-83,85-86,88-91H,6-7,9-11,13-14,17,19-21,25-28,32-34,38,40H2,1H3 |
| InChIKey | DWVVYZMIEVBPQB-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 289.28 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 95 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1291.55 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|