C72H82N4O12 — CID 163095164
CID 163095164 (PubChem CID 163095164) has the molecular formula C72H82N4O12 and a molecular weight of 1195.46 g/mol.
| Compound Name | CID 163095164 |
|---|---|
| PubChem CID | 163095164 |
| Molecular Formula | C72H82N4O12 |
| Molecular Weight | 1195.46 g/mol |
| Exact Mass | 1194.59 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CC(CCCO)C5(C4)NC(C(C)O)CCC5n4c(-c5cccc(O)c5)cc5[nH]ccc54)C4CC(O)CCC4C3C2CC(=O)CC(CCc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C72H82N4O12/c1-41(79)58-21-23-67(76-61-24-25-73-60(61)37-62(76)43-9-7-11-46(80)30-43)72(75-58)40-71(39-45(72)10-8-26-77)38-44-31-56-53-35-64(84)65(86-2)36-54(53)55(69(44)52-20-18-47(81)34-57(52)71)33-48(82)32-49(19-16-42-17-22-63(83)66(29-42)87-28-27-78)88-68(85)15-6-4-13-51-50-12-3-5-14-59(50)74-70(51)56/h3,5,7,9,11-12,14,17,22,24-25,29-31,35-37,41,44-45,47,49,52,55,57-58,67,69,73-75,77-81,83-84H,8,10,13,15-16,18-21,23,26-28,32-34,38-40H2,1-2H3 |
| InChIKey | FSNUIOVDQXLCIK-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 251.98 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 88 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.46 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|