C24H37BrO5 — CID 163072587
[(1R,4R,4aR,7S,8aR)-4-[(2S,3R)-2-acetyloxy-3-hydroxy-3-methylpent-4-enyl]-7-bromo-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 163072587) has the molecular formula C24H37BrO5 and a molecular weight of 485.46 g/mol. Its IUPAC name is [(1R,4R,4aR,7S,8aR)-4-[(2S,3R)-2-acetyloxy-3-hydroxy-3-methylpent-4-enyl]-7-bromo-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1R,4R,4aR,7S,8aR)-4-[(2S,3R)-2-acetyloxy-3-hydroxy-3-methylpent-4-enyl]-7-bromo-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 163072587 |
| Molecular Formula | C24H37BrO5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [(1R,4R,4aR,7S,8aR)-4-[(2S,3R)-2-acetyloxy-3-hydroxy-3-methylpent-4-enyl]-7-bromo-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | C=C[C@@](C)(O)[C@H](C[C@@H]1C(=C)C[C@@H](OC(C)=O)[C@H]2C(C)(C)[C@@H](Br)CC[C@]12C)OC(C)=O |
| InChI | InChI=1S/C24H37BrO5/c1-9-24(8,28)20(30-16(4)27)13-17-14(2)12-18(29-15(3)26)21-22(5,6)19(25)10-11-23(17,21)7/h9,17-21,28H,1-2,10-13H2,3-8H3/t17-,18-,19+,20+,21+,23-,24-/m1/s1 |
| InChIKey | HPFWMQVWLKRZSO-WYSAOPPGSA-N |
| XLogP | 4.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|