C20H28O2 — CID 163076026
7-ethenyl-5-hydroxy-4b,7,10a-trimethyl-1-methylidene-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-4-one (PubChem CID 163076026) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 7-ethenyl-5-hydroxy-4b,7,10a-trimethyl-1-methylidene-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-4-one.
| Compound Name | 7-ethenyl-5-hydroxy-4b,7,10a-trimethyl-1-methylidene-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-4-one |
|---|---|
| PubChem CID | 163076026 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 7-ethenyl-5-hydroxy-4b,7,10a-trimethyl-1-methylidene-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-4-one |
| SMILES | C=CC1(C)CC(O)C2(C)C(CCC3(C)C(=C)C=CC(=O)C32)C1 |
| InChI | InChI=1S/C20H28O2/c1-6-18(3)11-14-9-10-19(4)13(2)7-8-15(21)17(19)20(14,5)16(22)12-18/h6-8,14,16-17,22H,1-2,9-12H2,3-5H3 |
| InChIKey | PCYIYFKJVBYGAH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|