C24H32N2O5 — CID 163077120
(3S,3aR,4R,4aR,5R,9aR)-3-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 163077120) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is (3S,3aR,4R,4aR,5R,9aR)-3-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,4R,4aR,5R,9aR)-3-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 163077120 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (3S,3aR,4R,4aR,5R,9aR)-3-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC=C2C[C@H]3OC(=O)[C@H](CN4CCN(C(=O)c5ccco5)CC4)[C@@H]3[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C24H32N2O5/c1-15-5-3-6-16-13-19-20(21(27)24(15,16)2)17(23(29)31-19)14-25-8-10-26(11-9-25)22(28)18-7-4-12-30-18/h4,6-7,12,15,17,19-21,27H,3,5,8-11,13-14H2,1-2H3/t15-,17-,19-,20+,21-,24-/m1/s1 |
| InChIKey | KJPDWMMNIXDJJC-ZBFWMLHDSA-N |
| XLogP | 2.32 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|