C31H42N2O6 — CID 163083579
methyl 2-[6-[[(6R,7R,8S,9R)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoylamino]acetate (PubChem CID 163083579) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is methyl 2-[6-[[(6R,7R,8S,9R)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoylamino]acetate.
| Compound Name | methyl 2-[6-[[(6R,7R,8S,9R)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoylamino]acetate |
|---|---|
| PubChem CID | 163083579 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | methyl 2-[6-[[(6R,7R,8S,9R)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoylamino]acetate |
| SMILES | COC(=O)CNC(=O)C=CCC=CNC(=O)C=C(C)C=C[C@@H](C)[C@@H](OC)[C@@H](C)[C@@H](C=Cc1ccccc1)OC |
| InChI | InChI=1S/C31H42N2O6/c1-23(21-29(35)32-20-12-8-11-15-28(34)33-22-30(36)38-5)16-17-24(2)31(39-6)25(3)27(37-4)19-18-26-13-9-7-10-14-26/h7,9-21,24-25,27,31H,8,22H2,1-6H3,(H,32,35)(H,33,34)/t24-,25+,27-,31-/m1/s1 |
| InChIKey | XHTUDGVBJDVOEZ-RQJGXFNESA-N |
| XLogP | 4.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|