C25H40O3 — CID 163084139
(1S,2S)-1-[(2S)-2-methyloxiran-2-yl]-3-[(1S,2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]propane-1,2-diol (PubChem CID 163084139) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (1S,2S)-1-[(2S)-2-methyloxiran-2-yl]-3-[(1S,2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]propane-1,2-diol.
| Compound Name | (1S,2S)-1-[(2S)-2-methyloxiran-2-yl]-3-[(1S,2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]propane-1,2-diol |
|---|---|
| PubChem CID | 163084139 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (1S,2S)-1-[(2S)-2-methyloxiran-2-yl]-3-[(1S,2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]propane-1,2-diol |
| SMILES | C[C@H]1CC[C@@]23C1=C[C@@]1(C)CC[C@](C)(C[C@H](O)[C@H](O)[C@]4(C)CO4)[C@H]1[C@@H]2CC[C@@H]3C |
| InChI | InChI=1S/C25H40O3/c1-15-8-9-25-16(2)6-7-17(25)20-22(3,12-18(15)25)10-11-23(20,4)13-19(26)21(27)24(5)14-28-24/h12,15-17,19-21,26-27H,6-11,13-14H2,1-5H3/t15-,16-,17-,19-,20-,21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | ACLFJDGGWZBSDG-FVSVLNFLSA-N |
| XLogP | 4.71 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|