C17H29NO2P2 — CID 158348651
(1R,2S)-2-[benzyl-[methyl(phosphanyl)phosphanyl]amino]-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-ol (PubChem CID 158348651) has the molecular formula C17H29NO2P2 and a molecular weight of 341.37 g/mol. Its IUPAC name is (1R,2S)-2-[benzyl-[methyl(phosphanyl)phosphanyl]amino]-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-ol.
| Compound Name | (1R,2S)-2-[benzyl-[methyl(phosphanyl)phosphanyl]amino]-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 158348651 |
| Molecular Formula | C17H29NO2P2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (1R,2S)-2-[benzyl-[methyl(phosphanyl)phosphanyl]amino]-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-ol |
| SMILES | CC(C)C[C@@H]([C@@H](O)[C@@]1(C)CO1)N(Cc1ccccc1)P(C)P |
| InChI | InChI=1S/C17H29NO2P2/c1-13(2)10-15(16(19)17(3)12-20-17)18(22(4)21)11-14-8-6-5-7-9-14/h5-9,13,15-16,19H,10-12,21H2,1-4H3/t15-,16+,17+,22?/m0/s1 |
| InChIKey | GSAWMEFKKSKPSB-UMDQJPCGSA-N |
| XLogP | 3.87 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|