C25H40O4 — CID 10250668
1,2,4-trihydroxy-2-methyl-5-[(2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]pentan-3-one (PubChem CID 10250668) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 1,2,4-trihydroxy-2-methyl-5-[(2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]pentan-3-one.
| Compound Name | 1,2,4-trihydroxy-2-methyl-5-[(2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]pentan-3-one |
|---|---|
| PubChem CID | 10250668 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 1,2,4-trihydroxy-2-methyl-5-[(2S,5S,6R,7R,10R,13S)-2,7,10,13-tetramethyl-7-tetracyclo[10.3.0.01,5.06,10]pentadec-11-enyl]pentan-3-one |
| SMILES | C[C@H]1CCC23C1=C[C@@]1(C)CC[C@](C)(CC(O)C(=O)C(C)(O)CO)[C@H]1[C@@H]2CC[C@@H]3C |
| InChI | InChI=1S/C25H40O4/c1-15-8-9-25-16(2)6-7-17(25)20-22(3,12-18(15)25)10-11-23(20,4)13-19(27)21(28)24(5,29)14-26/h12,15-17,19-20,26-27,29H,6-11,13-14H2,1-5H3/t15-,16-,17-,19?,20-,22+,23+,24?,25?/m0/s1 |
| InChIKey | WCMVXSJCZKPSHR-PASLWQKRSA-N |
| XLogP | 3.87 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|