C22H42O2 — CID 153074593
1-(1,2,2,3-tetramethylcyclopentyl)propan-2-yl 2,2,3,4,4-pentamethylpentanoate (PubChem CID 153074593) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-(1,2,2,3-tetramethylcyclopentyl)propan-2-yl 2,2,3,4,4-pentamethylpentanoate.
| Compound Name | 1-(1,2,2,3-tetramethylcyclopentyl)propan-2-yl 2,2,3,4,4-pentamethylpentanoate |
|---|---|
| PubChem CID | 153074593 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 1-(1,2,2,3-tetramethylcyclopentyl)propan-2-yl 2,2,3,4,4-pentamethylpentanoate |
| SMILES | CC(CC1(C)CCC(C)C1(C)C)OC(=O)C(C)(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O2/c1-15-12-13-22(11,21(15,9)10)14-16(2)24-18(23)20(7,8)17(3)19(4,5)6/h15-17H,12-14H2,1-11H3 |
| InChIKey | VMASKNWYKVIXGX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |