C30H22O7 — CID 163085231
1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-3-[(2S)-7-hydroxy-2-(4-hydroxyphenyl)-2H-chromen-3-yl]phenyl]prop-2-en-1-one (PubChem CID 163085231) has the molecular formula C30H22O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-3-[(2S)-7-hydroxy-2-(4-hydroxyphenyl)-2H-chromen-3-yl]phenyl]prop-2-en-1-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-3-[(2S)-7-hydroxy-2-(4-hydroxyphenyl)-2H-chromen-3-yl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163085231 |
| Molecular Formula | C30H22O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-3-[(2S)-7-hydroxy-2-(4-hydroxyphenyl)-2H-chromen-3-yl]phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(O)c(C2=Cc3ccc(O)cc3O[C@H]2c2ccc(O)cc2)c1)c1ccc(O)cc1O |
| InChI | InChI=1S/C30H22O7/c31-20-6-3-18(4-7-20)30-25(14-19-5-8-22(33)16-29(19)37-30)24-13-17(2-12-27(24)35)1-11-26(34)23-10-9-21(32)15-28(23)36/h1-16,30-33,35-36H/t30-/m0/s1 |
| InChIKey | WTOVYMCGAAHKCJ-PMERELPUSA-N |
| XLogP | 5.78 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|