C16H14O3S — CID 10827074
(E)-1-(2,4-dihydroxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 10827074) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10827074 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C/C(=O)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C16H14O3S/c1-20-13-6-2-11(3-7-13)4-9-15(18)14-8-5-12(17)10-16(14)19/h2-10,17,19H,1H3/b9-4+ |
| InChIKey | KGGQFROOWCKPNR-RUDMXATFSA-N |
| XLogP | 3.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|