C20H20O5S — CID 10067885
2-[3-hydroxy-4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]-2-methylpropanoic acid (PubChem CID 10067885) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-[3-hydroxy-4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-hydroxy-4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10067885 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[3-hydroxy-4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CSc1ccc(/C=C/C(=O)c2ccc(OC(C)(C)C(=O)O)cc2O)cc1 |
| InChI | InChI=1S/C20H20O5S/c1-20(2,19(23)24)25-14-7-10-16(18(22)12-14)17(21)11-6-13-4-8-15(26-3)9-5-13/h4-12,22H,1-3H3,(H,23,24)/b11-6+ |
| InChIKey | NMAMXEVDBMNIPL-IZZDOVSWSA-N |
| XLogP | 4.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|