C31H50O7 — CID 163086018
[(3S,5R,6S,7S,10R,11R,13R,17R)-6-acetyloxy-3,5,11-trihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 163086018) has the molecular formula C31H50O7 and a molecular weight of 534.73 g/mol. Its IUPAC name is [(3S,5R,6S,7S,10R,11R,13R,17R)-6-acetyloxy-3,5,11-trihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(3S,5R,6S,7S,10R,11R,13R,17R)-6-acetyloxy-3,5,11-trihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 163086018 |
| Molecular Formula | C31H50O7 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | [(3S,5R,6S,7S,10R,11R,13R,17R)-6-acetyloxy-3,5,11-trihydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C2=C([C@H](O)C[C@@]3(C)C2CC[C@@H]3[C@H](C)CCCC(C)C)[C@@]2(C)CC[C@H](O)C[C@]2(O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H50O7/c1-17(2)9-8-10-18(3)22-11-12-23-25-26(24(35)16-29(22,23)6)30(7)14-13-21(34)15-31(30,36)28(38-20(5)33)27(25)37-19(4)32/h17-18,21-24,27-28,34-36H,8-16H2,1-7H3/t18-,21+,22-,23?,24-,27+,28+,29-,30-,31+/m1/s1 |
| InChIKey | PLCXDTMXCFEKKN-JFBBIKFASA-N |
| XLogP | 4.70 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|