C29H48O7 — CID 162919936
[(2R,3R,5R,6R,9R,10S,11R,13R,14R,17R)-2,3,5,6,9-pentahydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 162919936) has the molecular formula C29H48O7 and a molecular weight of 508.70 g/mol. Its IUPAC name is [(2R,3R,5R,6R,9R,10S,11R,13R,14R,17R)-2,3,5,6,9-pentahydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(2R,3R,5R,6R,9R,10S,11R,13R,14R,17R)-2,3,5,6,9-pentahydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 162919936 |
| Molecular Formula | C29H48O7 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | [(2R,3R,5R,6R,9R,10S,11R,13R,14R,17R)-2,3,5,6,9-pentahydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]2C2=C[C@@H](O)[C@@]3(O)C[C@@H](O)[C@H](O)C[C@]3(C)[C@]21O |
| InChI | InChI=1S/C29H48O7/c1-16(2)8-7-9-17(3)19-10-11-20-21-12-24(33)28(34)14-23(32)22(31)13-27(28,6)29(21,35)25(36-18(4)30)15-26(19,20)5/h12,16-17,19-20,22-25,31-35H,7-11,13-15H2,1-6H3/t17-,19-,20+,22-,23-,24-,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | VCNJGAZWSBAIDJ-FZPBTJBSSA-N |
| XLogP | 3.10 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|