C27H46O6 — CID 74052244
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol (PubChem CID 74052244) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
|---|---|
| PubChem CID | 74052244 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
| SMILES | CC(C)CCCC(C)C1CCC2C3=CC(O)C4(O)CC(O)C(O)CC4(C)C3(O)C(O)CC21C |
| InChI | InChI=1S/C27H46O6/c1-15(2)7-6-8-16(3)17-9-10-18-19-11-22(30)26(32)13-21(29)20(28)12-25(26,5)27(19,33)23(31)14-24(17,18)4/h11,15-18,20-23,28-33H,6-10,12-14H2,1-5H3 |
| InChIKey | SJPWEPGYDAKSQO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|