C27H44O7 — CID 23426001
(2R,3R,5R,6R,9R,10R,11R,13R,17R)-10-(hydroxymethyl)-13-methyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol (PubChem CID 23426001) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is (2R,3R,5R,6R,9R,10R,11R,13R,17R)-10-(hydroxymethyl)-13-methyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol.
| Compound Name | (2R,3R,5R,6R,9R,10R,11R,13R,17R)-10-(hydroxymethyl)-13-methyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
|---|---|
| PubChem CID | 23426001 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (2R,3R,5R,6R,9R,10R,11R,13R,17R)-10-(hydroxymethyl)-13-methyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
| SMILES | CC(C)C/C=C/[C@@H](C)[C@H]1CCC2C3=C[C@@H](O)[C@@]4(O)C[C@@H](O)[C@H](O)C[C@]4(CO)[C@@]3(O)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C27H44O7/c1-15(2)6-5-7-16(3)17-8-9-18-19-10-22(31)26(33)12-21(30)20(29)11-25(26,14-28)27(19,34)23(32)13-24(17,18)4/h5,7,10,15-18,20-23,28-34H,6,8-9,11-14H2,1-4H3/b7-5+/t16-,17-,18?,20-,21-,22-,23-,24-,25-,26+,27+/m1/s1 |
| InChIKey | KTHUUFNXXMIJOM-ZOUAOUSSSA-N |
| XLogP | 1.28 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|