C27H46O7 — CID 163031706
13-(hydroxymethyl)-10-methyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol (PubChem CID 163031706) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is 13-(hydroxymethyl)-10-methyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol.
| Compound Name | 13-(hydroxymethyl)-10-methyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
|---|---|
| PubChem CID | 163031706 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 13-(hydroxymethyl)-10-methyl-17-(6-methylheptan-2-yl)-2,3,4,6,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,5,6,9,11-hexol |
| SMILES | CC(C)CCCC(C)C1CCC2C3=CC(O)C4(O)CC(O)C(O)CC4(C)C3(O)C(O)CC21CO |
| InChI | InChI=1S/C27H46O7/c1-15(2)6-5-7-16(3)17-8-9-18-19-10-22(31)26(33)12-21(30)20(29)11-24(26,4)27(19,34)23(32)13-25(17,18)14-28/h10,15-18,20-23,28-34H,5-9,11-14H2,1-4H3 |
| InChIKey | HGFGWMLTAMPSBT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|