C27H44O5 — CID 74034361
2-(hydroxymethyl)-15-methyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-ene-5,7,8-triol (PubChem CID 74034361) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 2-(hydroxymethyl)-15-methyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-ene-5,7,8-triol.
| Compound Name | 2-(hydroxymethyl)-15-methyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-ene-5,7,8-triol |
|---|---|
| PubChem CID | 74034361 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 2-(hydroxymethyl)-15-methyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-ene-5,7,8-triol |
| SMILES | CC(C)CCCC(C)C1CCC2C3=CC(O)C4(O)CC(O)CCC4(CO)C34OC4CC21C |
| InChI | InChI=1S/C27H44O5/c1-16(2)6-5-7-17(3)19-8-9-20-21-12-22(30)26(31)13-18(29)10-11-25(26,15-28)27(21)23(32-27)14-24(19,20)4/h12,16-20,22-23,28-31H,5-11,13-15H2,1-4H3 |
| InChIKey | OTKIUMWOGJSAJR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|