C33H50O8 — CID 44566203
[(1R,2R,5S,7R,8S,11R,14R,15R,17S)-5,8-diacetyloxy-7-hydroxy-15-methyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-2-yl]methyl acetate (PubChem CID 44566203) has the molecular formula C33H50O8 and a molecular weight of 574.76 g/mol. Its IUPAC name is [(1R,2R,5S,7R,8S,11R,14R,15R,17S)-5,8-diacetyloxy-7-hydroxy-15-methyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-2-yl]methyl acetate.
| Compound Name | [(1R,2R,5S,7R,8S,11R,14R,15R,17S)-5,8-diacetyloxy-7-hydroxy-15-methyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44566203 |
| Molecular Formula | C33H50O8 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | [(1R,2R,5S,7R,8S,11R,14R,15R,17S)-5,8-diacetyloxy-7-hydroxy-15-methyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC[C@H](OC(C)=O)C[C@]1(O)[C@@H](OC(C)=O)C=C1[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)C[C@@H]3O[C@@]132 |
| InChI | InChI=1S/C33H50O8/c1-19(2)9-8-10-20(3)25-11-12-26-27-15-28(40-23(6)36)32(37)16-24(39-22(5)35)13-14-31(32,18-38-21(4)34)33(27)29(41-33)17-30(25,26)7/h15,19-20,24-26,28-29,37H,8-14,16-18H2,1-7H3/t20-,24+,25-,26+,28+,29+,30-,31-,32+,33+/m1/s1 |
| InChIKey | NHDFVAIYKMNPIQ-KAAFDXRISA-N |
| XLogP | 5.29 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|