C20H24O6 — CID 163105824
4,6a,7,12-tetrahydroxy-8-methoxy-3-methyl-2,3,4,5,6,7,12,12a-octahydrobenzo[a]anthracen-1-one (PubChem CID 163105824) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4,6a,7,12-tetrahydroxy-8-methoxy-3-methyl-2,3,4,5,6,7,12,12a-octahydrobenzo[a]anthracen-1-one.
| Compound Name | 4,6a,7,12-tetrahydroxy-8-methoxy-3-methyl-2,3,4,5,6,7,12,12a-octahydrobenzo[a]anthracen-1-one |
|---|---|
| PubChem CID | 163105824 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4,6a,7,12-tetrahydroxy-8-methoxy-3-methyl-2,3,4,5,6,7,12,12a-octahydrobenzo[a]anthracen-1-one |
| SMILES | COc1cccc2c1C(O)C1(O)CCC3=C(C(=O)CC(C)C3O)C1C2O |
| InChI | InChI=1S/C20H24O6/c1-9-8-12(21)14-11(17(9)22)6-7-20(25)16(14)18(23)10-4-3-5-13(26-2)15(10)19(20)24/h3-5,9,16-19,22-25H,6-8H2,1-2H3 |
| InChIKey | RJWQJLOBPVJMCW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |