C20H28O4 — CID 163111536
9-ethenyl-8-hydroxy-5,5,9,11b-tetramethyl-2,5a,6,7,8,10-hexahydro-1H-benzo[g][2]benzoxepine-3,11-dione (PubChem CID 163111536) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 9-ethenyl-8-hydroxy-5,5,9,11b-tetramethyl-2,5a,6,7,8,10-hexahydro-1H-benzo[g][2]benzoxepine-3,11-dione.
| Compound Name | 9-ethenyl-8-hydroxy-5,5,9,11b-tetramethyl-2,5a,6,7,8,10-hexahydro-1H-benzo[g][2]benzoxepine-3,11-dione |
|---|---|
| PubChem CID | 163111536 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 9-ethenyl-8-hydroxy-5,5,9,11b-tetramethyl-2,5a,6,7,8,10-hexahydro-1H-benzo[g][2]benzoxepine-3,11-dione |
| SMILES | C=CC1(C)CC(=O)C2=C(CCC3C(C)(C)OC(=O)CCC23C)C1O |
| InChI | InChI=1S/C20H28O4/c1-6-19(4)11-13(21)16-12(17(19)23)7-8-14-18(2,3)24-15(22)9-10-20(14,16)5/h6,14,17,23H,1,7-11H2,2-5H3 |
| InChIKey | NIMXJYFXUBSDPY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|