C24H32O5 — CID 163111859
13-hydroxy-1-(2,4,6-trihydroxyphenyl)octadeca-6,9,11,15-tetraen-1-one (PubChem CID 163111859) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 13-hydroxy-1-(2,4,6-trihydroxyphenyl)octadeca-6,9,11,15-tetraen-1-one.
| Compound Name | 13-hydroxy-1-(2,4,6-trihydroxyphenyl)octadeca-6,9,11,15-tetraen-1-one |
|---|---|
| PubChem CID | 163111859 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 13-hydroxy-1-(2,4,6-trihydroxyphenyl)octadeca-6,9,11,15-tetraen-1-one |
| SMILES | CCC=CCC(O)C=CC=CCC=CCCCCC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C24H32O5/c1-2-3-11-14-19(25)15-12-9-7-5-4-6-8-10-13-16-21(27)24-22(28)17-20(26)18-23(24)29/h3-4,6-7,9,11-12,15,17-19,25-26,28-29H,2,5,8,10,13-14,16H2,1H3 |
| InChIKey | OGSHIPWCZJVZBH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|