C30H50O — CID 163112019
9,13,18-trimethyl-8-(4,5,6-trimethylhept-3-en-2-yl)-17-oxapentacyclo[14.1.1.01,13.04,12.05,9]octadecane (PubChem CID 163112019) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 9,13,18-trimethyl-8-(4,5,6-trimethylhept-3-en-2-yl)-17-oxapentacyclo[14.1.1.01,13.04,12.05,9]octadecane.
| Compound Name | 9,13,18-trimethyl-8-(4,5,6-trimethylhept-3-en-2-yl)-17-oxapentacyclo[14.1.1.01,13.04,12.05,9]octadecane |
|---|---|
| PubChem CID | 163112019 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 9,13,18-trimethyl-8-(4,5,6-trimethylhept-3-en-2-yl)-17-oxapentacyclo[14.1.1.01,13.04,12.05,9]octadecane |
| SMILES | CC(=CC(C)C1CCC2C3CCC45OC(CCC4(C)C3CCC12C)C5C)C(C)C(C)C |
| InChI | InChI=1S/C30H50O/c1-18(2)21(5)19(3)17-20(4)24-9-10-25-23-11-16-30-22(6)27(31-30)13-15-29(30,8)26(23)12-14-28(24,25)7/h17-18,20-27H,9-16H2,1-8H3 |
| InChIKey | ORWALBULDJXEQK-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|