About 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione
3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (PubChem CID 163112483) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
Analyze 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione?
The IUPAC name of 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (CID 163112483) is 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
What is the SMILES notation for 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione?
The canonical SMILES for 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione is O=C1C2CCCN2C(=O)C2(O)CCCN12.
What is the InChIKey of 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione?
The InChIKey is PYRVMBRYGHXZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c13-8-7-3-1-5-11(7)9(14)10(15)4-2-6-12(8)10/h7,15H,1-6H2.
What are the key properties of 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione?
3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione has a molecular weight of 210.23 g/mol, XLogP of -0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione is sourced from PubChem (CID 163112483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).