C20H28N4O4S2Zn+2 — CID 3640101
zinc bis(8-oxo-2-oxoniumylidene-1,7-diazatricyclo[7.3.0.03,7]dodecane-3-thiolate) (PubChem CID 3640101) has the molecular formula C20H28N4O4S2Zn+2 and a molecular weight of 517.99 g/mol. Its IUPAC name is zinc bis(8-oxo-2-oxoniumylidene-1,7-diazatricyclo[7.3.0.03,7]dodecane-3-thiolate).
| Compound Name | zinc bis(8-oxo-2-oxoniumylidene-1,7-diazatricyclo[7.3.0.03,7]dodecane-3-thiolate) |
|---|---|
| PubChem CID | 3640101 |
| Molecular Formula | C20H28N4O4S2Zn+2 |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | zinc bis(8-oxo-2-oxoniumylidene-1,7-diazatricyclo[7.3.0.03,7]dodecane-3-thiolate) |
| SMILES | [H]/[O+]=C1\N2CCCC2C(=O)N2CCCC12[S-].[H]/[O+]=C1\N2CCCC2C(=O)N2CCCC12[S-].[Zn+2] |
| InChI | InChI=1S/2C10H14N2O2S.Zn/c2*13-8-7-3-1-5-11(7)9(14)10(15)4-2-6-12(8)10;/h2*7,15H,1-6H2;/q;;+2 |
| InChIKey | CYTINLJCKKFENH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|