C21H23N3O4 — CID 163190946
(3R,9S,11R)-3-hydroxy-12,12-dimethylspiro[1,7-diazatricyclo[7.5.0.03,7]tetradec-13-ene-11,2'-1H-indole]-2,3',8-trione (PubChem CID 163190946) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3R,9S,11R)-3-hydroxy-12,12-dimethylspiro[1,7-diazatricyclo[7.5.0.03,7]tetradec-13-ene-11,2'-1H-indole]-2,3',8-trione.
| Compound Name | (3R,9S,11R)-3-hydroxy-12,12-dimethylspiro[1,7-diazatricyclo[7.5.0.03,7]tetradec-13-ene-11,2'-1H-indole]-2,3',8-trione |
|---|---|
| PubChem CID | 163190946 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3R,9S,11R)-3-hydroxy-12,12-dimethylspiro[1,7-diazatricyclo[7.5.0.03,7]tetradec-13-ene-11,2'-1H-indole]-2,3',8-trione |
| SMILES | CC1(C)C=CN2C(=O)[C@]3(O)CCCN3C(=O)[C@@H]2C[C@@]12Nc1ccccc1C2=O |
| InChI | InChI=1S/C21H23N3O4/c1-19(2)9-11-23-15(17(26)24-10-5-8-21(24,28)18(23)27)12-20(19)16(25)13-6-3-4-7-14(13)22-20/h3-4,6-7,9,11,15,22,28H,5,8,10,12H2,1-2H3/t15-,20-,21+/m0/s1 |
| InChIKey | BGIQDYPEQQKSSV-ONGXBYRLSA-N |
| XLogP | 1.50 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |