C29H26ClNO6 — CID 163114566
9-chloro-1-(2,4-dimethoxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one (PubChem CID 163114566) has the molecular formula C29H26ClNO6 and a molecular weight of 519.98 g/mol. Its IUPAC name is 9-chloro-1-(2,4-dimethoxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one.
| Compound Name | 9-chloro-1-(2,4-dimethoxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one |
|---|---|
| PubChem CID | 163114566 |
| Molecular Formula | C29H26ClNO6 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 9-chloro-1-(2,4-dimethoxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one |
| SMILES | COc1cc(C)c(-c2nc(C)cc3cc4c(c(O)c23)C(=O)c2c(cc(O)c(Cl)c2O)C4(C)C)c(OC)c1 |
| InChI | InChI=1S/C29H26ClNO6/c1-12-7-15(36-5)10-19(37-6)20(12)25-21-14(8-13(2)31-25)9-16-22(26(21)33)27(34)23-17(29(16,3)4)11-18(32)24(30)28(23)35/h7-11,32-33,35H,1-6H3 |
| InChIKey | VRRHYEHJWDKDCI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |